C17H23N3O5S — CID 47909871
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1-methylsulfonylpiperidin-3-yl)acetamide (PubChem CID 47909871) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1-methylsulfonylpiperidin-3-yl)acetamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1-methylsulfonylpiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 47909871 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1-methylsulfonylpiperidin-3-yl)acetamide |
| SMILES | CS(=O)(=O)N1CCCC(NC(=O)CN2C(=O)C3C4C=CC(C4)C3C2=O)C1 |
| InChI | InChI=1S/C17H23N3O5S/c1-26(24,25)19-6-2-3-12(8-19)18-13(21)9-20-16(22)14-10-4-5-11(7-10)15(14)17(20)23/h4-5,10-12,14-15H,2-3,6-9H2,1H3,(H,18,21) |
| InChIKey | QASNWUGVXSKGFZ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|