C10H17N3O3S2 — CID 47908698
2-(cyanomethylsulfanyl)-N-(1-methylsulfonylpiperidin-3-yl)acetamide (PubChem CID 47908698) has the molecular formula C10H17N3O3S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-(1-methylsulfonylpiperidin-3-yl)acetamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-(1-methylsulfonylpiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 47908698 |
| Molecular Formula | C10H17N3O3S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-(1-methylsulfonylpiperidin-3-yl)acetamide |
| SMILES | CS(=O)(=O)N1CCCC(NC(=O)CSCC#N)C1 |
| InChI | InChI=1S/C10H17N3O3S2/c1-18(15,16)13-5-2-3-9(7-13)12-10(14)8-17-6-4-11/h9H,2-3,5-8H2,1H3,(H,12,14) |
| InChIKey | OIVQOFSUAGKNEI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|