C14H27N3O3S — CID 47766211
3-ethyl-N-(1-methylsulfonylpiperidin-3-yl)piperidine-1-carboxamide (PubChem CID 47766211) has the molecular formula C14H27N3O3S and a molecular weight of 317.46 g/mol. Its IUPAC name is 3-ethyl-N-(1-methylsulfonylpiperidin-3-yl)piperidine-1-carboxamide.
| Compound Name | 3-ethyl-N-(1-methylsulfonylpiperidin-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 47766211 |
| Molecular Formula | C14H27N3O3S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 3-ethyl-N-(1-methylsulfonylpiperidin-3-yl)piperidine-1-carboxamide |
| SMILES | CCC1CCCN(C(=O)NC2CCCN(S(C)(=O)=O)C2)C1 |
| InChI | InChI=1S/C14H27N3O3S/c1-3-12-6-4-8-16(10-12)14(18)15-13-7-5-9-17(11-13)21(2,19)20/h12-13H,3-11H2,1-2H3,(H,15,18) |
| InChIKey | JHCCVRUFUKSXPV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |