C14H25N3O5S — CID 122122461
5-methyl-1-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]piperidine-3-carboxylic acid (PubChem CID 122122461) has the molecular formula C14H25N3O5S and a molecular weight of 347.44 g/mol. Its IUPAC name is 5-methyl-1-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122122461 |
| Molecular Formula | C14H25N3O5S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 5-methyl-1-[(1-methylsulfonylpiperidin-3-yl)carbamoyl]piperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)NC2CCCN(S(C)(=O)=O)C2)C1 |
| InChI | InChI=1S/C14H25N3O5S/c1-10-6-11(13(18)19)8-16(7-10)14(20)15-12-4-3-5-17(9-12)23(2,21)22/h10-12H,3-9H2,1-2H3,(H,15,20)(H,18,19) |
| InChIKey | QHEQMMAMNABCFK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |