C24H28N4O4 — CID 55517957
2-[4-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetyl]amino]piperidin-1-yl]-N-phenylacetamide (PubChem CID 55517957) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[4-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetyl]amino]piperidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetyl]amino]piperidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 55517957 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-[4-[[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)acetyl]amino]piperidin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1CCC(NC(=O)CN2C(=O)C3C4C=CC(C4)C3C2=O)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C24H28N4O4/c29-19(25-17-4-2-1-3-5-17)13-27-10-8-18(9-11-27)26-20(30)14-28-23(31)21-15-6-7-16(12-15)22(21)24(28)32/h1-7,15-16,18,21-22H,8-14H2,(H,25,29)(H,26,30) |
| InChIKey | HIFGZYBKLMIJSK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|