C23H27N5O3 — CID 24629861
2-[4-[[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]amino]piperidin-1-yl]-N-phenylacetamide (PubChem CID 24629861) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[4-[[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]amino]piperidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]amino]piperidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 24629861 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-[4-[[2-(3-methyl-2-oxobenzimidazol-1-yl)acetyl]amino]piperidin-1-yl]-N-phenylacetamide |
| SMILES | Cn1c(=O)n(CC(=O)NC2CCN(CC(=O)Nc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C23H27N5O3/c1-26-19-9-5-6-10-20(19)28(23(26)31)16-22(30)25-18-11-13-27(14-12-18)15-21(29)24-17-7-3-2-4-8-17/h2-10,18H,11-16H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | XPFDOFAFEBLQMJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |