C18H25N5O3 — CID 134047876
2-[4-[[2-(3-ethyl-2-oxobenzimidazol-1-yl)acetyl]amino]piperidin-1-yl]acetamide (PubChem CID 134047876) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[4-[[2-(3-ethyl-2-oxobenzimidazol-1-yl)acetyl]amino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[[2-(3-ethyl-2-oxobenzimidazol-1-yl)acetyl]amino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 134047876 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2-[4-[[2-(3-ethyl-2-oxobenzimidazol-1-yl)acetyl]amino]piperidin-1-yl]acetamide |
| SMILES | CCn1c(=O)n(CC(=O)NC2CCN(CC(N)=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C18H25N5O3/c1-2-22-14-5-3-4-6-15(14)23(18(22)26)12-17(25)20-13-7-9-21(10-8-13)11-16(19)24/h3-6,13H,2,7-12H2,1H3,(H2,19,24)(H,20,25) |
| InChIKey | HBNBJIKZGJKRCM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |