C18H22F3N3O2 — CID 18169394
2-(3-ethyl-2-oxobenzimidazol-1-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 18169394) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is 2-(3-ethyl-2-oxobenzimidazol-1-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-(3-ethyl-2-oxobenzimidazol-1-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 18169394 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-(3-ethyl-2-oxobenzimidazol-1-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | CCn1c(=O)n(CC(=O)NC2CCCC(C(F)(F)F)C2)c2ccccc21 |
| InChI | InChI=1S/C18H22F3N3O2/c1-2-23-14-8-3-4-9-15(14)24(17(23)26)11-16(25)22-13-7-5-6-12(10-13)18(19,20)21/h3-4,8-9,12-13H,2,5-7,10-11H2,1H3,(H,22,25) |
| InChIKey | AFNJIUBXCFZTHI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |