C18H27ClN4O2 — CID 119610899
N-[2-(aminomethyl)cyclohexyl]-2-(3-ethyl-2-oxobenzimidazol-1-yl)acetamide;hydrochloride (PubChem CID 119610899) has the molecular formula C18H27ClN4O2 and a molecular weight of 366.89 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2-(3-ethyl-2-oxobenzimidazol-1-yl)acetamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2-(3-ethyl-2-oxobenzimidazol-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119610899 |
| Molecular Formula | C18H27ClN4O2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2-(3-ethyl-2-oxobenzimidazol-1-yl)acetamide;hydrochloride |
| SMILES | CCn1c(=O)n(CC(=O)NC2CCCCC2CN)c2ccccc21.Cl |
| InChI | InChI=1S/C18H26N4O2.ClH/c1-2-21-15-9-5-6-10-16(15)22(18(21)24)12-17(23)20-14-8-4-3-7-13(14)11-19;/h5-6,9-10,13-14H,2-4,7-8,11-12,19H2,1H3,(H,20,23);1H |
| InChIKey | MWSFOLCVJJRHDF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |