C16H22N4O2 — CID 119374924
1-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-3-ethylbenzimidazol-2-one (PubChem CID 119374924) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-3-ethylbenzimidazol-2-one.
| Compound Name | 1-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-3-ethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 119374924 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-[2-(4-aminopiperidin-1-yl)-2-oxoethyl]-3-ethylbenzimidazol-2-one |
| SMILES | CCn1c(=O)n(CC(=O)N2CCC(N)CC2)c2ccccc21 |
| InChI | InChI=1S/C16H22N4O2/c1-2-19-13-5-3-4-6-14(13)20(16(19)22)11-15(21)18-9-7-12(17)8-10-18/h3-6,12H,2,7-11,17H2,1H3 |
| InChIKey | NBNRIQNXGXIDEQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |