C17H22N4O3 — CID 94178599
(3R)-1-[2-(3-ethyl-2-oxobenzimidazol-1-yl)acetyl]piperidine-3-carboxamide (PubChem CID 94178599) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (3R)-1-[2-(3-ethyl-2-oxobenzimidazol-1-yl)acetyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-(3-ethyl-2-oxobenzimidazol-1-yl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94178599 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (3R)-1-[2-(3-ethyl-2-oxobenzimidazol-1-yl)acetyl]piperidine-3-carboxamide |
| SMILES | CCn1c(=O)n(CC(=O)N2CCC[C@@H](C(N)=O)C2)c2ccccc21 |
| InChI | InChI=1S/C17H22N4O3/c1-2-20-13-7-3-4-8-14(13)21(17(20)24)11-15(22)19-9-5-6-12(10-19)16(18)23/h3-4,7-8,12H,2,5-6,9-11H2,1H3,(H2,18,23)/t12-/m1/s1 |
| InChIKey | MBZPGWCJNUESSF-GFCCVEGCSA-N |
| XLogP | 0.55 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |