C20H22N4O4 — CID 38909999
1-ethyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]benzimidazol-2-one (PubChem CID 38909999) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]benzimidazol-2-one.
| Compound Name | 1-ethyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 38909999 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-ethyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]benzimidazol-2-one |
| SMILES | CCn1c(=O)n(CC(=O)N2CCN(C(=O)c3ccco3)CC2)c2ccccc21 |
| InChI | InChI=1S/C20H22N4O4/c1-2-23-15-6-3-4-7-16(15)24(20(23)27)14-18(25)21-9-11-22(12-10-21)19(26)17-8-5-13-28-17/h3-8,13H,2,9-12,14H2,1H3 |
| InChIKey | UKUNKPWCGFOVJR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 80.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |