C18H17FN4O4 — CID 113195390
6-fluoro-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-1H-benzimidazol-2-one (PubChem CID 113195390) has the molecular formula C18H17FN4O4 and a molecular weight of 372.36 g/mol. Its IUPAC name is 6-fluoro-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-1H-benzimidazol-2-one.
| Compound Name | 6-fluoro-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 113195390 |
| Molecular Formula | C18H17FN4O4 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 6-fluoro-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-1H-benzimidazol-2-one |
| SMILES | O=C(Cn1c(=O)[nH]c2cc(F)ccc21)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H17FN4O4/c19-12-3-4-14-13(10-12)20-18(26)23(14)11-16(24)21-5-7-22(8-6-21)17(25)15-2-1-9-27-15/h1-4,9-10H,5-8,11H2,(H,20,26) |
| InChIKey | FSZMEWPCIZKFCH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |