C14H24F3N3O — CID 79322864
2-(4-aminopiperidin-1-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 79322864) has the molecular formula C14H24F3N3O and a molecular weight of 307.36 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-(4-aminopiperidin-1-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 79322864 |
| Molecular Formula | C14H24F3N3O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | NC1CCN(CC(=O)NC2CCCC(C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C14H24F3N3O/c15-14(16,17)10-2-1-3-12(8-10)19-13(21)9-20-6-4-11(18)5-7-20/h10-12H,1-9,18H2,(H,19,21) |
| InChIKey | SVQOJGNERQVQBN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |