C14H22F3NO2 — CID 111430402
2-(1-hydroxycyclopentyl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 111430402) has the molecular formula C14H22F3NO2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-(1-hydroxycyclopentyl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-(1-hydroxycyclopentyl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 111430402 |
| Molecular Formula | C14H22F3NO2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-(1-hydroxycyclopentyl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | O=C(CC1(O)CCCC1)NC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H22F3NO2/c15-14(16,17)10-4-3-5-11(8-10)18-12(19)9-13(20)6-1-2-7-13/h10-11,20H,1-9H2,(H,18,19) |
| InChIKey | BDOYXRUCGLKMCB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |