C18H26F3N3O3 — CID 55523413
2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 55523413) has the molecular formula C18H26F3N3O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 55523413 |
| Molecular Formula | C18H26F3N3O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | CN1C(=O)N(CC(=O)NC2CCCC(C(F)(F)F)C2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C18H26F3N3O3/c1-23-16(27)24(15(26)17(23)8-3-2-4-9-17)11-14(25)22-13-7-5-6-12(10-13)18(19,20)21/h12-13H,2-11H2,1H3,(H,22,25) |
| InChIKey | NHPHVFXQGGNNNG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|