C17H29ClN4O3 — CID 119477685
N-(4-aminocyclohexyl)-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride (PubChem CID 119477685) has the molecular formula C17H29ClN4O3 and a molecular weight of 372.90 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119477685 |
| Molecular Formula | C17H29ClN4O3 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide;hydrochloride |
| SMILES | CN1C(=O)N(CC(=O)NC2CCC(N)CC2)C(=O)C12CCCCC2.Cl |
| InChI | InChI=1S/C17H28N4O3.ClH/c1-20-16(24)21(15(23)17(20)9-3-2-4-10-17)11-14(22)19-13-7-5-12(18)6-8-13;/h12-13H,2-11,18H2,1H3,(H,19,22);1H |
| InChIKey | DGRLROLYOOVHDT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|