C15H24F3NO2 — CID 111331748
2-(1-hydroxycyclohexyl)-N-[4-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 111331748) has the molecular formula C15H24F3NO2 and a molecular weight of 307.36 g/mol. Its IUPAC name is 2-(1-hydroxycyclohexyl)-N-[4-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-(1-hydroxycyclohexyl)-N-[4-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 111331748 |
| Molecular Formula | C15H24F3NO2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-(1-hydroxycyclohexyl)-N-[4-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | O=C(CC1(O)CCCCC1)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H24F3NO2/c16-15(17,18)11-4-6-12(7-5-11)19-13(20)10-14(21)8-2-1-3-9-14/h11-12,21H,1-10H2,(H,19,20) |
| InChIKey | OMQCHOSXFBHOCN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |