C12H21F3N2O — CID 60718312
2-(propan-2-ylamino)-N-[4-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 60718312) has the molecular formula C12H21F3N2O and a molecular weight of 266.31 g/mol. Its IUPAC name is 2-(propan-2-ylamino)-N-[4-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-(propan-2-ylamino)-N-[4-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 60718312 |
| Molecular Formula | C12H21F3N2O |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-(propan-2-ylamino)-N-[4-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | CC(C)NCC(=O)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3N2O/c1-8(2)16-7-11(18)17-10-5-3-9(4-6-10)12(13,14)15/h8-10,16H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | PPHWABSRXOSCCI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |