About 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide
2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 94151419) has the molecular formula C10H14F3N5O
and a molecular weight of 277.25 g/mol. Its IUPAC name is 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide.
Molecular Properties
| Compound Name | 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide |
| PubChem CID | 94151419 |
| Molecular Formula | C10H14F3N5O |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | O=C(Cn1cnnn1)N[C@H]1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C10H14F3N5O/c11-10(12,13)7-2-1-3-8(4-7)15-9(19)5-18-6-14-16-17-18/h6-8H,1-5H2,(H,15,19)/t7-,8+/m1/s1 |
| InChIKey | YVUYSDNQGSQRTM-SFYZADRCSA-N |
| XLogP | 0.91 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide?
The IUPAC name of 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide (CID 94151419) is 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide.
What is the SMILES notation for 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide?
The canonical SMILES for 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide is O=C(Cn1cnnn1)N[C@H]1CCC[C@@H](C(F)(F)F)C1.
What is the InChIKey of 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide?
The InChIKey is YVUYSDNQGSQRTM-SFYZADRCSA-N. The full InChI is InChI=1S/C10H14F3N5O/c11-10(12,13)7-2-1-3-8(4-7)15-9(19)5-18-6-14-16-17-18/h6-8H,1-5H2,(H,15,19)/t7-,8+/m1/s1.
What are the key properties of 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide?
2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide has a molecular weight of 277.25 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tetrazol-1-yl)-N-[(1S,3R)-3-(trifluoromethyl)cyclohexyl]acetamide is sourced from PubChem (CID 94151419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).