C18H28N8O4 — CID 154922434
3-(2-ethylimidazol-1-yl)-N-[(1S,3R)-3-[[2-(tetrazol-1-yl)acetyl]amino]cyclohexyl]propanamide;formic acid (PubChem CID 154922434) has the molecular formula C18H28N8O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-(2-ethylimidazol-1-yl)-N-[(1S,3R)-3-[[2-(tetrazol-1-yl)acetyl]amino]cyclohexyl]propanamide;formic acid.
| Compound Name | 3-(2-ethylimidazol-1-yl)-N-[(1S,3R)-3-[[2-(tetrazol-1-yl)acetyl]amino]cyclohexyl]propanamide;formic acid |
|---|---|
| PubChem CID | 154922434 |
| Molecular Formula | C18H28N8O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 3-(2-ethylimidazol-1-yl)-N-[(1S,3R)-3-[[2-(tetrazol-1-yl)acetyl]amino]cyclohexyl]propanamide;formic acid |
| SMILES | CCc1nccn1CCC(=O)N[C@H]1CCC[C@@H](NC(=O)Cn2cnnn2)C1.O=CO |
| InChI | InChI=1S/C17H26N8O2.CH2O2/c1-2-15-18-7-9-24(15)8-6-16(26)20-13-4-3-5-14(10-13)21-17(27)11-25-12-19-22-23-25;2-1-3/h7,9,12-14H,2-6,8,10-11H2,1H3,(H,20,26)(H,21,27);1H,(H,2,3)/t13-,14+;/m0./s1 |
| InChIKey | DCXPVLFHWVVJEF-LMRHVHIWSA-N |
| XLogP | -0.23 |
| TPSA | 156.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|