C21H30N4O5 — CID 154912251
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-(2-ethylimidazol-1-yl)propanamide;formic acid (PubChem CID 154912251) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-(2-ethylimidazol-1-yl)propanamide;formic acid.
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-(2-ethylimidazol-1-yl)propanamide;formic acid |
|---|---|
| PubChem CID | 154912251 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-(2-ethylimidazol-1-yl)propanamide;formic acid |
| SMILES | CCc1nccn1CCC(=O)NCCN1CCc2ccccc2C1.O=CO.O=CO |
| InChI | InChI=1S/C19H26N4O.2CH2O2/c1-2-18-20-10-14-23(18)12-8-19(24)21-9-13-22-11-7-16-5-3-4-6-17(16)15-22;2*2-1-3/h3-6,10,14H,2,7-9,11-13,15H2,1H3,(H,21,24);2*1H,(H,2,3) |
| InChIKey | VUZBXYXORCNUAK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|