C20H34N4O7S — CID 154912721
N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-3-(2-ethylimidazol-1-yl)propanamide;formic acid (PubChem CID 154912721) has the molecular formula C20H34N4O7S and a molecular weight of 474.58 g/mol. Its IUPAC name is N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-3-(2-ethylimidazol-1-yl)propanamide;formic acid.
| Compound Name | N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-3-(2-ethylimidazol-1-yl)propanamide;formic acid |
|---|---|
| PubChem CID | 154912721 |
| Molecular Formula | C20H34N4O7S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-3-(2-ethylimidazol-1-yl)propanamide;formic acid |
| SMILES | CCc1nccn1CCC(=O)NC1CCN(C2CCS(=O)(=O)CC2)CC1.O=CO.O=CO |
| InChI | InChI=1S/C18H30N4O3S.2CH2O2/c1-2-17-19-8-12-22(17)11-5-18(23)20-15-3-9-21(10-4-15)16-6-13-26(24,25)14-7-16;2*2-1-3/h8,12,15-16H,2-7,9-11,13-14H2,1H3,(H,20,23);2*1H,(H,2,3) |
| InChIKey | YJESMSOHOIHANL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|