C18H26N2O4S — CID 118771156
N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-2-(3-hydroxyphenyl)acetamide (PubChem CID 118771156) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-2-(3-hydroxyphenyl)acetamide.
| Compound Name | N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-2-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 118771156 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-2-(3-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1cccc(O)c1)NC1CCN(C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C18H26N2O4S/c21-17-3-1-2-14(12-17)13-18(22)19-15-4-8-20(9-5-15)16-6-10-25(23,24)11-7-16/h1-3,12,15-16,21H,4-11,13H2,(H,19,22) |
| InChIKey | UMXSTGYWIBTTQT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |