C19H28N2O3S — CID 91761634
N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-2,5-dimethylbenzamide (PubChem CID 91761634) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-2,5-dimethylbenzamide.
| Compound Name | N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 91761634 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)NC2CCN(C3CCS(=O)(=O)CC3)CC2)c1 |
| InChI | InChI=1S/C19H28N2O3S/c1-14-3-4-15(2)18(13-14)19(22)20-16-5-9-21(10-6-16)17-7-11-25(23,24)12-8-17/h3-4,13,16-17H,5-12H2,1-2H3,(H,20,22) |
| InChIKey | MTFOLGQQLJPGGQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |