C13H16FNO3S — CID 62509384
N-(1,1-dioxothian-4-yl)-2-fluoro-5-methylbenzamide (PubChem CID 62509384) has the molecular formula C13H16FNO3S and a molecular weight of 285.34 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-2-fluoro-5-methylbenzamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-2-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 62509384 |
| Molecular Formula | C13H16FNO3S |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-2-fluoro-5-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)NC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C13H16FNO3S/c1-9-2-3-12(14)11(8-9)13(16)15-10-4-6-19(17,18)7-5-10/h2-3,8,10H,4-7H2,1H3,(H,15,16) |
| InChIKey | OIWFTGAJVDDIDX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |