C18H26FNO — CID 103966079
2-fluoro-5-methyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide (PubChem CID 103966079) has the molecular formula C18H26FNO and a molecular weight of 291.41 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide.
| Compound Name | 2-fluoro-5-methyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 103966079 |
| Molecular Formula | C18H26FNO |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 2-fluoro-5-methyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide |
| SMILES | Cc1ccc(F)c(C(=O)NC2CC(C)(C)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C18H26FNO/c1-12-6-7-15(19)14(8-12)16(21)20-13-9-17(2,3)11-18(4,5)10-13/h6-8,13H,9-11H2,1-5H3,(H,20,21) |
| InChIKey | AFAZEKVPNVAFLM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |