C17H24FNOS — CID 107034256
4-fluoro-3-sulfanyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide (PubChem CID 107034256) has the molecular formula C17H24FNOS and a molecular weight of 309.45 g/mol. Its IUPAC name is 4-fluoro-3-sulfanyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide.
| Compound Name | 4-fluoro-3-sulfanyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 107034256 |
| Molecular Formula | C17H24FNOS |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4-fluoro-3-sulfanyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2ccc(F)c(S)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H24FNOS/c1-16(2)8-12(9-17(3,4)10-16)19-15(20)11-5-6-13(18)14(21)7-11/h5-7,12,21H,8-10H2,1-4H3,(H,19,20) |
| InChIKey | MYWAXVQJLYSCLK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|