C17H25ClN2O — CID 103965109
3-amino-4-chloro-N-(3,3,5,5-tetramethylcyclohexyl)benzamide (PubChem CID 103965109) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 3-amino-4-chloro-N-(3,3,5,5-tetramethylcyclohexyl)benzamide.
| Compound Name | 3-amino-4-chloro-N-(3,3,5,5-tetramethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 103965109 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-amino-4-chloro-N-(3,3,5,5-tetramethylcyclohexyl)benzamide |
| SMILES | CC1(C)CC(NC(=O)c2ccc(Cl)c(N)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H25ClN2O/c1-16(2)8-12(9-17(3,4)10-16)20-15(21)11-5-6-13(18)14(19)7-11/h5-7,12H,8-10,19H2,1-4H3,(H,20,21) |
| InChIKey | IHVUXZSFHWQDCR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|