C14H17ClN2O3 — CID 63042958
3-[(3-amino-4-chlorobenzoyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 63042958) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 3-[(3-amino-4-chlorobenzoyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[(3-amino-4-chlorobenzoyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63042958 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-[(3-amino-4-chlorobenzoyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | Nc1cc(C(=O)NC2CCCC(C(=O)O)C2)ccc1Cl |
| InChI | InChI=1S/C14H17ClN2O3/c15-11-5-4-8(7-12(11)16)13(18)17-10-3-1-2-9(6-10)14(19)20/h4-5,7,9-10H,1-3,6,16H2,(H,17,18)(H,19,20) |
| InChIKey | CEBKLZWOKLVBIC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|