C12H13ClN2O4 — CID 66239735
4-[(3-amino-4-chlorobenzoyl)amino]oxolane-3-carboxylic acid (PubChem CID 66239735) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is 4-[(3-amino-4-chlorobenzoyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(3-amino-4-chlorobenzoyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66239735 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-[(3-amino-4-chlorobenzoyl)amino]oxolane-3-carboxylic acid |
| SMILES | Nc1cc(C(=O)NC2COCC2C(=O)O)ccc1Cl |
| InChI | InChI=1S/C12H13ClN2O4/c13-8-2-1-6(3-9(8)14)11(16)15-10-5-19-4-7(10)12(17)18/h1-3,7,10H,4-5,14H2,(H,15,16)(H,17,18) |
| InChIKey | YYGJFIKQPTXHAO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|