C12H12FNO4 — CID 66223767
4-[(3-fluorobenzoyl)amino]oxolane-3-carboxylic acid (PubChem CID 66223767) has the molecular formula C12H12FNO4 and a molecular weight of 253.23 g/mol. Its IUPAC name is 4-[(3-fluorobenzoyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(3-fluorobenzoyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66223767 |
| Molecular Formula | C12H12FNO4 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 4-[(3-fluorobenzoyl)amino]oxolane-3-carboxylic acid |
| SMILES | O=C(NC1COCC1C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H12FNO4/c13-8-3-1-2-7(4-8)11(15)14-10-6-18-5-9(10)12(16)17/h1-4,9-10H,5-6H2,(H,14,15)(H,16,17) |
| InChIKey | HKTNSPSVTOTKNR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |