C12H12Cl2N2O4 — CID 82833163
4-[(4-amino-3,5-dichlorobenzoyl)amino]oxolane-3-carboxylic acid (PubChem CID 82833163) has the molecular formula C12H12Cl2N2O4 and a molecular weight of 319.14 g/mol. Its IUPAC name is 4-[(4-amino-3,5-dichlorobenzoyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(4-amino-3,5-dichlorobenzoyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 82833163 |
| Molecular Formula | C12H12Cl2N2O4 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 4-[(4-amino-3,5-dichlorobenzoyl)amino]oxolane-3-carboxylic acid |
| SMILES | Nc1c(Cl)cc(C(=O)NC2COCC2C(=O)O)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O4/c13-7-1-5(2-8(14)10(7)15)11(17)16-9-4-20-3-6(9)12(18)19/h1-2,6,9H,3-4,15H2,(H,16,17)(H,18,19) |
| InChIKey | LMLHFTMIFDLYCF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|