C12H11Cl2NO4 — CID 66221387
4-[(2,5-dichlorobenzoyl)amino]oxolane-3-carboxylic acid (PubChem CID 66221387) has the molecular formula C12H11Cl2NO4 and a molecular weight of 304.13 g/mol. Its IUPAC name is 4-[(2,5-dichlorobenzoyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(2,5-dichlorobenzoyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66221387 |
| Molecular Formula | C12H11Cl2NO4 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 4-[(2,5-dichlorobenzoyl)amino]oxolane-3-carboxylic acid |
| SMILES | O=C(NC1COCC1C(=O)O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H11Cl2NO4/c13-6-1-2-9(14)7(3-6)11(16)15-10-5-19-4-8(10)12(17)18/h1-3,8,10H,4-5H2,(H,15,16)(H,17,18) |
| InChIKey | XXMZVAWUZNPJED-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |