C20H18Cl4N2O2 — CID 2165949
2,5-dichloro-N-[4-[(2,5-dichlorobenzoyl)amino]cyclohexyl]benzamide (PubChem CID 2165949) has the molecular formula C20H18Cl4N2O2 and a molecular weight of 460.19 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-[(2,5-dichlorobenzoyl)amino]cyclohexyl]benzamide.
| Compound Name | 2,5-dichloro-N-[4-[(2,5-dichlorobenzoyl)amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 2165949 |
| Molecular Formula | C20H18Cl4N2O2 |
| Molecular Weight | 460.19 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 2,5-dichloro-N-[4-[(2,5-dichlorobenzoyl)amino]cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(NC(=O)c2cc(Cl)ccc2Cl)CC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H18Cl4N2O2/c21-11-1-7-17(23)15(9-11)19(27)25-13-3-5-14(6-4-13)26-20(28)16-10-12(22)2-8-18(16)24/h1-2,7-10,13-14H,3-6H2,(H,25,27)(H,26,28) |
| InChIKey | AWZGNKRORULWRY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.19 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |