C13H16Cl2N2O3S — CID 108561587
2,5-dichloro-N-(1-methylsulfonylpiperidin-4-yl)benzamide (PubChem CID 108561587) has the molecular formula C13H16Cl2N2O3S and a molecular weight of 351.26 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-methylsulfonylpiperidin-4-yl)benzamide.
| Compound Name | 2,5-dichloro-N-(1-methylsulfonylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 108561587 |
| Molecular Formula | C13H16Cl2N2O3S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2,5-dichloro-N-(1-methylsulfonylpiperidin-4-yl)benzamide |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C13H16Cl2N2O3S/c1-21(19,20)17-6-4-10(5-7-17)16-13(18)11-8-9(14)2-3-12(11)15/h2-3,8,10H,4-7H2,1H3,(H,16,18) |
| InChIKey | BOWLKASCTJPXMC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |