C13H17ClFN3O3S — CID 110706232
1-(3-chloro-4-fluorophenyl)-3-(1-methylsulfonylpiperidin-4-yl)urea (PubChem CID 110706232) has the molecular formula C13H17ClFN3O3S and a molecular weight of 349.82 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(1-methylsulfonylpiperidin-4-yl)urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(1-methylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 110706232 |
| Molecular Formula | C13H17ClFN3O3S |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(1-methylsulfonylpiperidin-4-yl)urea |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H17ClFN3O3S/c1-22(20,21)18-6-4-9(5-7-18)16-13(19)17-10-2-3-12(15)11(14)8-10/h2-3,8-9H,4-7H2,1H3,(H2,16,17,19) |
| InChIKey | SGIWBCDWPSPITQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |