C14H20ClN3OS — CID 71864855
1-(3-chloro-4-methylsulfanylphenyl)-3-(1-methylpiperidin-4-yl)urea (PubChem CID 71864855) has the molecular formula C14H20ClN3OS and a molecular weight of 313.85 g/mol. Its IUPAC name is 1-(3-chloro-4-methylsulfanylphenyl)-3-(1-methylpiperidin-4-yl)urea.
| Compound Name | 1-(3-chloro-4-methylsulfanylphenyl)-3-(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 71864855 |
| Molecular Formula | C14H20ClN3OS |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(3-chloro-4-methylsulfanylphenyl)-3-(1-methylpiperidin-4-yl)urea |
| SMILES | CSc1ccc(NC(=O)NC2CCN(C)CC2)cc1Cl |
| InChI | InChI=1S/C14H20ClN3OS/c1-18-7-5-10(6-8-18)16-14(19)17-11-3-4-13(20-2)12(15)9-11/h3-4,9-10H,5-8H2,1-2H3,(H2,16,17,19) |
| InChIKey | GLLQOHKYMRCQQC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |