C13H17BrClN3S — CID 100754869
1-(4-bromo-3-chlorophenyl)-3-(1-methylpiperidin-4-yl)thiourea (PubChem CID 100754869) has the molecular formula C13H17BrClN3S and a molecular weight of 362.72 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-(1-methylpiperidin-4-yl)thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-(1-methylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 100754869 |
| Molecular Formula | C13H17BrClN3S |
| Molecular Weight | 362.72 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-(1-methylpiperidin-4-yl)thiourea |
| SMILES | CN1CCC(NC(=S)Nc2ccc(Br)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H17BrClN3S/c1-18-6-4-9(5-7-18)16-13(19)17-10-2-3-11(14)12(15)8-10/h2-3,8-9H,4-7H2,1H3,(H2,16,17,19) |
| InChIKey | JURWXILTRCXAJA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|