C12H14BrClN2S — CID 2725349
N-(4-bromo-3-chlorophenyl)piperidine-1-carbothioamide (PubChem CID 2725349) has the molecular formula C12H14BrClN2S and a molecular weight of 333.68 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)piperidine-1-carbothioamide.
| Compound Name | N-(4-bromo-3-chlorophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 2725349 |
| Molecular Formula | C12H14BrClN2S |
| Molecular Weight | 333.68 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)piperidine-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Br)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C12H14BrClN2S/c13-10-5-4-9(8-11(10)14)15-12(17)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7H2,(H,15,17) |
| InChIKey | LLLFEWKSEYGWFN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.68 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|