C11H12Cl2N2OS — CID 773259
N-(3,4-dichlorophenyl)morpholine-4-carbothioamide (PubChem CID 773259) has the molecular formula C11H12Cl2N2OS and a molecular weight of 291.20 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)morpholine-4-carbothioamide.
| Compound Name | N-(3,4-dichlorophenyl)morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 773259 |
| Molecular Formula | C11H12Cl2N2OS |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | N-(3,4-dichlorophenyl)morpholine-4-carbothioamide |
| SMILES | S=C(Nc1ccc(Cl)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C11H12Cl2N2OS/c12-9-2-1-8(7-10(9)13)14-11(17)15-3-5-16-6-4-15/h1-2,7H,3-6H2,(H,14,17) |
| InChIKey | NHZJPYQLZMECFJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|