C14H16Cl2N2O2S — CID 143208421
2-[1-[(3,4-dichlorophenyl)carbamothioyl]piperidin-4-yl]acetic acid (PubChem CID 143208421) has the molecular formula C14H16Cl2N2O2S and a molecular weight of 347.27 g/mol. Its IUPAC name is 2-[1-[(3,4-dichlorophenyl)carbamothioyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[(3,4-dichlorophenyl)carbamothioyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 143208421 |
| Molecular Formula | C14H16Cl2N2O2S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-[1-[(3,4-dichlorophenyl)carbamothioyl]piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(C(=S)Nc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H16Cl2N2O2S/c15-11-2-1-10(8-12(11)16)17-14(21)18-5-3-9(4-6-18)7-13(19)20/h1-2,8-9H,3-7H2,(H,17,21)(H,19,20) |
| InChIKey | NPTOIURJOGAWQM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|