C15H18Cl2N2OS2 — CID 5162545
[2-(3,4-dichloroanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate (PubChem CID 5162545) has the molecular formula C15H18Cl2N2OS2 and a molecular weight of 377.36 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate.
| Compound Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 5162545 |
| Molecular Formula | C15H18Cl2N2OS2 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 4-methylpiperidine-1-carbodithioate |
| SMILES | CC1CCN(C(=S)SCC(=O)Nc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H18Cl2N2OS2/c1-10-4-6-19(7-5-10)15(21)22-9-14(20)18-11-2-3-12(16)13(17)8-11/h2-3,8,10H,4-7,9H2,1H3,(H,18,20) |
| InChIKey | PSADUJSZNFFIGV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|