C15H20ClN3OS2 — CID 9423111
[2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-methylpiperazine-1-carbodithioate (PubChem CID 9423111) has the molecular formula C15H20ClN3OS2 and a molecular weight of 357.93 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-methylpiperazine-1-carbodithioate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-methylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 9423111 |
| Molecular Formula | C15H20ClN3OS2 |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 4-methylpiperazine-1-carbodithioate |
| SMILES | Cc1ccc(NC(=O)CSC(=S)N2CCN(C)CC2)cc1Cl |
| InChI | InChI=1S/C15H20ClN3OS2/c1-11-3-4-12(9-13(11)16)17-14(20)10-22-15(21)19-7-5-18(2)6-8-19/h3-4,9H,5-8,10H2,1-2H3,(H,17,20) |
| InChIKey | IWQZBSJYPHHGEP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|