C15H19N3O2S2 — CID 7607505
[2-(4-acetamidoanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 7607505) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7607505 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSC(=S)N2CCCC2)cc1 |
| InChI | InChI=1S/C15H19N3O2S2/c1-11(19)16-12-4-6-13(7-5-12)17-14(20)10-22-15(21)18-8-2-3-9-18/h4-7H,2-3,8-10H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | SAMOXKKWXRAGQK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|