C15H18N2O3S2 — CID 8660171
(2-anilino-2-oxoethyl) 2-(pyrrolidine-1-carbothioylsulfanyl)acetate (PubChem CID 8660171) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-(pyrrolidine-1-carbothioylsulfanyl)acetate.
| Compound Name | (2-anilino-2-oxoethyl) 2-(pyrrolidine-1-carbothioylsulfanyl)acetate |
|---|---|
| PubChem CID | 8660171 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-(pyrrolidine-1-carbothioylsulfanyl)acetate |
| SMILES | O=C(COC(=O)CSC(=S)N1CCCC1)Nc1ccccc1 |
| InChI | InChI=1S/C15H18N2O3S2/c18-13(16-12-6-2-1-3-7-12)10-20-14(19)11-22-15(21)17-8-4-5-9-17/h1-3,6-7H,4-5,8-11H2,(H,16,18) |
| InChIKey | JRIVNDKCXXNSLN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|