C17H24N2OS2 — CID 9484025
[2-(3-ethylanilino)-2-oxoethyl] azepane-1-carbodithioate (PubChem CID 9484025) has the molecular formula C17H24N2OS2 and a molecular weight of 336.53 g/mol. Its IUPAC name is [2-(3-ethylanilino)-2-oxoethyl] azepane-1-carbodithioate.
| Compound Name | [2-(3-ethylanilino)-2-oxoethyl] azepane-1-carbodithioate |
|---|---|
| PubChem CID | 9484025 |
| Molecular Formula | C17H24N2OS2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | [2-(3-ethylanilino)-2-oxoethyl] azepane-1-carbodithioate |
| SMILES | CCc1cccc(NC(=O)CSC(=S)N2CCCCCC2)c1 |
| InChI | InChI=1S/C17H24N2OS2/c1-2-14-8-7-9-15(12-14)18-16(20)13-22-17(21)19-10-5-3-4-6-11-19/h7-9,12H,2-6,10-11,13H2,1H3,(H,18,20) |
| InChIKey | KXPDBNFWNOMVST-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|