C18H25N3O4 — CID 129470928
methyl (3S)-1-[[2-(3-ethylanilino)-2-oxoethyl]carbamoyl]piperidine-3-carboxylate (PubChem CID 129470928) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is methyl (3S)-1-[[2-(3-ethylanilino)-2-oxoethyl]carbamoyl]piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-[[2-(3-ethylanilino)-2-oxoethyl]carbamoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 129470928 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | methyl (3S)-1-[[2-(3-ethylanilino)-2-oxoethyl]carbamoyl]piperidine-3-carboxylate |
| SMILES | CCc1cccc(NC(=O)CNC(=O)N2CCC[C@H](C(=O)OC)C2)c1 |
| InChI | InChI=1S/C18H25N3O4/c1-3-13-6-4-8-15(10-13)20-16(22)11-19-18(24)21-9-5-7-14(12-21)17(23)25-2/h4,6,8,10,14H,3,5,7,9,11-12H2,1-2H3,(H,19,24)(H,20,22)/t14-/m0/s1 |
| InChIKey | IPCOBJXGLOBBBH-AWEZNQCLSA-N |
| XLogP | 1.78 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |