C21H25N5O2S2 — CID 155514619
[2-oxo-2-[3-(pyridine-2-carbonylamino)anilino]ethyl] 4-ethylpiperazine-1-carbodithioate (PubChem CID 155514619) has the molecular formula C21H25N5O2S2 and a molecular weight of 443.60 g/mol. Its IUPAC name is [2-oxo-2-[3-(pyridine-2-carbonylamino)anilino]ethyl] 4-ethylpiperazine-1-carbodithioate.
| Compound Name | [2-oxo-2-[3-(pyridine-2-carbonylamino)anilino]ethyl] 4-ethylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 155514619 |
| Molecular Formula | C21H25N5O2S2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [2-oxo-2-[3-(pyridine-2-carbonylamino)anilino]ethyl] 4-ethylpiperazine-1-carbodithioate |
| SMILES | CCN1CCN(C(=S)SCC(=O)Nc2cccc(NC(=O)c3ccccn3)c2)CC1 |
| InChI | InChI=1S/C21H25N5O2S2/c1-2-25-10-12-26(13-11-25)21(29)30-15-19(27)23-16-6-5-7-17(14-16)24-20(28)18-8-3-4-9-22-18/h3-9,14H,2,10-13,15H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | RQULEZVOMNUAOM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|