C16H20F3N3O2S2 — CID 87048439
[2-oxo-2-[2-(trifluoromethoxy)anilino]ethyl] 4-ethylpiperazine-1-carbodithioate (PubChem CID 87048439) has the molecular formula C16H20F3N3O2S2 and a molecular weight of 407.48 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethoxy)anilino]ethyl] 4-ethylpiperazine-1-carbodithioate.
| Compound Name | [2-oxo-2-[2-(trifluoromethoxy)anilino]ethyl] 4-ethylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 87048439 |
| Molecular Formula | C16H20F3N3O2S2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethoxy)anilino]ethyl] 4-ethylpiperazine-1-carbodithioate |
| SMILES | CCN1CCN(C(=S)SCC(=O)Nc2ccccc2OC(F)(F)F)CC1 |
| InChI | InChI=1S/C16H20F3N3O2S2/c1-2-21-7-9-22(10-8-21)15(25)26-11-14(23)20-12-5-3-4-6-13(12)24-16(17,18)19/h3-6H,2,7-11H2,1H3,(H,20,23) |
| InChIKey | WJMQAAAKOWUJCN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|